C9H11ClFN3 — CID 79081830
2-chloro-N-(cyclobutylmethyl)-5-fluoropyrimidin-4-amine (PubChem CID 79081830) has the molecular formula C9H11ClFN3 and a molecular weight of 215.66 g/mol. Its IUPAC name is 2-chloro-N-(cyclobutylmethyl)-5-fluoropyrimidin-4-amine.
| Compound Name | 2-chloro-N-(cyclobutylmethyl)-5-fluoropyrimidin-4-amine |
|---|---|
| PubChem CID | 79081830 |
| Molecular Formula | C9H11ClFN3 |
| Molecular Weight | 215.66 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 2-chloro-N-(cyclobutylmethyl)-5-fluoropyrimidin-4-amine |
| SMILES | Fc1cnc(Cl)nc1NCC1CCC1 |
| InChI | InChI=1S/C9H11ClFN3/c10-9-13-5-7(11)8(14-9)12-4-6-2-1-3-6/h5-6H,1-4H2,(H,12,13,14) |
| InChIKey | SOBOBUSMAZJARX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.66 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |