C9H11ClFN3O2 — CID 79080521
2-chloro-N-(1,4-dioxan-2-ylmethyl)-5-fluoropyrimidin-4-amine (PubChem CID 79080521) has the molecular formula C9H11ClFN3O2 and a molecular weight of 247.66 g/mol. Its IUPAC name is 2-chloro-N-(1,4-dioxan-2-ylmethyl)-5-fluoropyrimidin-4-amine.
| Compound Name | 2-chloro-N-(1,4-dioxan-2-ylmethyl)-5-fluoropyrimidin-4-amine |
|---|---|
| PubChem CID | 79080521 |
| Molecular Formula | C9H11ClFN3O2 |
| Molecular Weight | 247.66 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 2-chloro-N-(1,4-dioxan-2-ylmethyl)-5-fluoropyrimidin-4-amine |
| SMILES | Fc1cnc(Cl)nc1NCC1COCCO1 |
| InChI | InChI=1S/C9H11ClFN3O2/c10-9-13-4-7(11)8(14-9)12-3-6-5-15-1-2-16-6/h4,6H,1-3,5H2,(H,12,13,14) |
| InChIKey | NAMKMSLCTACYOA-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.66 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |