C10H13ClFN3O — CID 79081086
2-chloro-5-fluoro-N-[2-(oxolan-2-yl)ethyl]pyrimidin-4-amine (PubChem CID 79081086) has the molecular formula C10H13ClFN3O and a molecular weight of 245.68 g/mol. Its IUPAC name is 2-chloro-5-fluoro-N-[2-(oxolan-2-yl)ethyl]pyrimidin-4-amine.
| Compound Name | 2-chloro-5-fluoro-N-[2-(oxolan-2-yl)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 79081086 |
| Molecular Formula | C10H13ClFN3O |
| Molecular Weight | 245.68 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 2-chloro-5-fluoro-N-[2-(oxolan-2-yl)ethyl]pyrimidin-4-amine |
| SMILES | Fc1cnc(Cl)nc1NCCC1CCCO1 |
| InChI | InChI=1S/C10H13ClFN3O/c11-10-14-6-8(12)9(15-10)13-4-3-7-2-1-5-16-7/h6-7H,1-5H2,(H,13,14,15) |
| InChIKey | YLISYTHRNGEJIB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.68 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |