C10H12BrFN2O2 — CID 104923956
5-bromo-N-(1,4-dioxan-2-ylmethyl)-3-fluoropyridin-2-amine (PubChem CID 104923956) has the molecular formula C10H12BrFN2O2 and a molecular weight of 291.12 g/mol. Its IUPAC name is 5-bromo-N-(1,4-dioxan-2-ylmethyl)-3-fluoropyridin-2-amine.
| Compound Name | 5-bromo-N-(1,4-dioxan-2-ylmethyl)-3-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 104923956 |
| Molecular Formula | C10H12BrFN2O2 |
| Molecular Weight | 291.12 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 5-bromo-N-(1,4-dioxan-2-ylmethyl)-3-fluoropyridin-2-amine |
| SMILES | Fc1cc(Br)cnc1NCC1COCCO1 |
| InChI | InChI=1S/C10H12BrFN2O2/c11-7-3-9(12)10(13-4-7)14-5-8-6-15-1-2-16-8/h3-4,8H,1-2,5-6H2,(H,13,14) |
| InChIKey | UJBNAUZCNNVMPC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.12 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |