C13H19BrFN3 — CID 114047966
N-[[2-(aminomethyl)cyclohexyl]methyl]-5-bromo-3-fluoropyridin-2-amine (PubChem CID 114047966) has the molecular formula C13H19BrFN3 and a molecular weight of 316.22 g/mol. Its IUPAC name is N-[[2-(aminomethyl)cyclohexyl]methyl]-5-bromo-3-fluoropyridin-2-amine.
| Compound Name | N-[[2-(aminomethyl)cyclohexyl]methyl]-5-bromo-3-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 114047966 |
| Molecular Formula | C13H19BrFN3 |
| Molecular Weight | 316.22 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | N-[[2-(aminomethyl)cyclohexyl]methyl]-5-bromo-3-fluoropyridin-2-amine |
| SMILES | NCC1CCCCC1CNc1ncc(Br)cc1F |
| InChI | InChI=1S/C13H19BrFN3/c14-11-5-12(15)13(18-8-11)17-7-10-4-2-1-3-9(10)6-16/h5,8-10H,1-4,6-7,16H2,(H,17,18) |
| InChIKey | LFSJBVKCOVSJDU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.22 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |