C12H15ClF2N2 — CID 112676581
N-[[2-(chloromethyl)cyclopentyl]methyl]-3,5-difluoropyridin-2-amine (PubChem CID 112676581) has the molecular formula C12H15ClF2N2 and a molecular weight of 260.71 g/mol. Its IUPAC name is N-[[2-(chloromethyl)cyclopentyl]methyl]-3,5-difluoropyridin-2-amine.
| Compound Name | N-[[2-(chloromethyl)cyclopentyl]methyl]-3,5-difluoropyridin-2-amine |
|---|---|
| PubChem CID | 112676581 |
| Molecular Formula | C12H15ClF2N2 |
| Molecular Weight | 260.71 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | N-[[2-(chloromethyl)cyclopentyl]methyl]-3,5-difluoropyridin-2-amine |
| SMILES | Fc1cnc(NCC2CCCC2CCl)c(F)c1 |
| InChI | InChI=1S/C12H15ClF2N2/c13-5-8-2-1-3-9(8)6-16-12-11(15)4-10(14)7-17-12/h4,7-9H,1-3,5-6H2,(H,16,17) |
| InChIKey | HQKRLMHTYFXCIQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.71 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|