C10H12F2N2O — CID 112675958
3-[[(3,5-difluoro-2-pyridinyl)amino]methyl]cyclobutan-1-ol (PubChem CID 112675958) has the molecular formula C10H12F2N2O and a molecular weight of 214.22 g/mol. Its IUPAC name is 3-[[(3,5-difluoro-2-pyridinyl)amino]methyl]cyclobutan-1-ol.
| Compound Name | 3-[[(3,5-difluoro-2-pyridinyl)amino]methyl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 112675958 |
| Molecular Formula | C10H12F2N2O |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 3-[[(3,5-difluoro-2-pyridinyl)amino]methyl]cyclobutan-1-ol |
| SMILES | OC1CC(CNc2ncc(F)cc2F)C1 |
| InChI | InChI=1S/C10H12F2N2O/c11-7-3-9(12)10(14-5-7)13-4-6-1-8(15)2-6/h3,5-6,8,15H,1-2,4H2,(H,13,14) |
| InChIKey | YYPORMMVISCOMC-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |