C10H14Cl2N4O2 — CID 102761703
3,5-dichloro-N-(1,4-dioxan-2-ylmethyl)-6-hydrazinylpyridin-2-amine (PubChem CID 102761703) has the molecular formula C10H14Cl2N4O2 and a molecular weight of 293.15 g/mol. Its IUPAC name is 3,5-dichloro-N-(1,4-dioxan-2-ylmethyl)-6-hydrazinylpyridin-2-amine.
| Compound Name | 3,5-dichloro-N-(1,4-dioxan-2-ylmethyl)-6-hydrazinylpyridin-2-amine |
|---|---|
| PubChem CID | 102761703 |
| Molecular Formula | C10H14Cl2N4O2 |
| Molecular Weight | 293.15 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 3,5-dichloro-N-(1,4-dioxan-2-ylmethyl)-6-hydrazinylpyridin-2-amine |
| SMILES | NNc1nc(NCC2COCCO2)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H14Cl2N4O2/c11-7-3-8(12)10(16-13)15-9(7)14-4-6-5-17-1-2-18-6/h3,6H,1-2,4-5,13H2,(H2,14,15,16) |
| InChIKey | KRCDYZREOYCCCU-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.15 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|