C11H13Cl3N2O — CID 102750873
3,5,6-trichloro-N-(oxan-3-ylmethyl)pyridin-2-amine (PubChem CID 102750873) has the molecular formula C11H13Cl3N2O and a molecular weight of 295.60 g/mol. Its IUPAC name is 3,5,6-trichloro-N-(oxan-3-ylmethyl)pyridin-2-amine.
| Compound Name | 3,5,6-trichloro-N-(oxan-3-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102750873 |
| Molecular Formula | C11H13Cl3N2O |
| Molecular Weight | 295.60 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 3,5,6-trichloro-N-(oxan-3-ylmethyl)pyridin-2-amine |
| SMILES | Clc1cc(Cl)c(NCC2CCCOC2)nc1Cl |
| InChI | InChI=1S/C11H13Cl3N2O/c12-8-4-9(13)11(16-10(8)14)15-5-7-2-1-3-17-6-7/h4,7H,1-3,5-6H2,(H,15,16) |
| InChIKey | RQHDBYOIHUURNK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.60 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|