C11H15ClN2O — CID 61020967
3-chloro-N-(oxan-3-ylmethyl)pyridin-2-amine (PubChem CID 61020967) has the molecular formula C11H15ClN2O and a molecular weight of 226.71 g/mol. Its IUPAC name is 3-chloro-N-(oxan-3-ylmethyl)pyridin-2-amine.
| Compound Name | 3-chloro-N-(oxan-3-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 61020967 |
| Molecular Formula | C11H15ClN2O |
| Molecular Weight | 226.71 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 3-chloro-N-(oxan-3-ylmethyl)pyridin-2-amine |
| SMILES | Clc1cccnc1NCC1CCCOC1 |
| InChI | InChI=1S/C11H15ClN2O/c12-10-4-1-5-13-11(10)14-7-9-3-2-6-15-8-9/h1,4-5,9H,2-3,6-8H2,(H,13,14) |
| InChIKey | UNWNBAYTYAGMLF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.71 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |