C9H13ClN2OS — CID 130686313
2-chloro-N-(oxan-3-ylmethyl)-1,3-thiazol-4-amine (PubChem CID 130686313) has the molecular formula C9H13ClN2OS and a molecular weight of 232.74 g/mol. Its IUPAC name is 2-chloro-N-(oxan-3-ylmethyl)-1,3-thiazol-4-amine.
| Compound Name | 2-chloro-N-(oxan-3-ylmethyl)-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 130686313 |
| Molecular Formula | C9H13ClN2OS |
| Molecular Weight | 232.74 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 2-chloro-N-(oxan-3-ylmethyl)-1,3-thiazol-4-amine |
| SMILES | Clc1nc(NCC2CCCOC2)cs1 |
| InChI | InChI=1S/C9H13ClN2OS/c10-9-12-8(6-14-9)11-4-7-2-1-3-13-5-7/h6-7,11H,1-5H2 |
| InChIKey | UHGMTYYBMXPPTO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.74 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |