C14H22ClN3O — CID 80954111
2-tert-butyl-6-chloro-N-(oxan-3-ylmethyl)pyrimidin-4-amine (PubChem CID 80954111) has the molecular formula C14H22ClN3O and a molecular weight of 283.80 g/mol. Its IUPAC name is 2-tert-butyl-6-chloro-N-(oxan-3-ylmethyl)pyrimidin-4-amine.
| Compound Name | 2-tert-butyl-6-chloro-N-(oxan-3-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80954111 |
| Molecular Formula | C14H22ClN3O |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 2-tert-butyl-6-chloro-N-(oxan-3-ylmethyl)pyrimidin-4-amine |
| SMILES | CC(C)(C)c1nc(Cl)cc(NCC2CCCOC2)n1 |
| InChI | InChI=1S/C14H22ClN3O/c1-14(2,3)13-17-11(15)7-12(18-13)16-8-10-5-4-6-19-9-10/h7,10H,4-6,8-9H2,1-3H3,(H,16,17,18) |
| InChIKey | VGDOQIYOTLMZLB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |