C11H16ClN3O — CID 80936100
6-chloro-2-ethyl-N-(oxolan-3-ylmethyl)pyrimidin-4-amine (PubChem CID 80936100) has the molecular formula C11H16ClN3O and a molecular weight of 241.72 g/mol. Its IUPAC name is 6-chloro-2-ethyl-N-(oxolan-3-ylmethyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-2-ethyl-N-(oxolan-3-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80936100 |
| Molecular Formula | C11H16ClN3O |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 6-chloro-2-ethyl-N-(oxolan-3-ylmethyl)pyrimidin-4-amine |
| SMILES | CCc1nc(Cl)cc(NCC2CCOC2)n1 |
| InChI | InChI=1S/C11H16ClN3O/c1-2-10-14-9(12)5-11(15-10)13-6-8-3-4-16-7-8/h5,8H,2-4,6-7H2,1H3,(H,13,14,15) |
| InChIKey | KWPABGGXNIZZAE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |