C13H17Cl3N2O — CID 102751354
[2-[[(3,5,6-trichloro-2-pyridinyl)amino]methyl]cyclohexyl]methanol (PubChem CID 102751354) has the molecular formula C13H17Cl3N2O and a molecular weight of 323.65 g/mol. Its IUPAC name is [2-[[(3,5,6-trichloro-2-pyridinyl)amino]methyl]cyclohexyl]methanol.
| Compound Name | [2-[[(3,5,6-trichloro-2-pyridinyl)amino]methyl]cyclohexyl]methanol |
|---|---|
| PubChem CID | 102751354 |
| Molecular Formula | C13H17Cl3N2O |
| Molecular Weight | 323.65 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | [2-[[(3,5,6-trichloro-2-pyridinyl)amino]methyl]cyclohexyl]methanol |
| SMILES | OCC1CCCCC1CNc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H17Cl3N2O/c14-10-5-11(15)13(18-12(10)16)17-6-8-3-1-2-4-9(8)7-19/h5,8-9,19H,1-4,6-7H2,(H,17,18) |
| InChIKey | BTULLSMMEMOKFT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.65 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|