C12H17ClFN3O — CID 79076621
[2-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]methyl]cyclohexyl]methanol (PubChem CID 79076621) has the molecular formula C12H17ClFN3O and a molecular weight of 273.74 g/mol. Its IUPAC name is [2-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]methyl]cyclohexyl]methanol.
| Compound Name | [2-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]methyl]cyclohexyl]methanol |
|---|---|
| PubChem CID | 79076621 |
| Molecular Formula | C12H17ClFN3O |
| Molecular Weight | 273.74 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | [2-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]methyl]cyclohexyl]methanol |
| SMILES | OCC1CCCCC1CNc1nc(Cl)ncc1F |
| InChI | InChI=1S/C12H17ClFN3O/c13-12-16-6-10(14)11(17-12)15-5-8-3-1-2-4-9(8)7-18/h6,8-9,18H,1-5,7H2,(H,15,16,17) |
| InChIKey | AVSOIFBQTIJDHT-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.74 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |