About 2-[(1R,4R)-4-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]methyl]cyclopent-2-en-1-yl]acetamide
2-[(1R,4R)-4-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]methyl]cyclopent-2-en-1-yl]acetamide (PubChem CID 88987089) has the molecular formula C12H14ClFN4O
and a molecular weight of 284.72 g/mol. Its IUPAC name is 2-[(1R,4R)-4-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]methyl]cyclopent-2-en-1-yl]acetamide.
Molecular Properties
| Compound Name | 2-[(1R,4R)-4-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]methyl]cyclopent-2-en-1-yl]acetamide |
| PubChem CID | 88987089 |
| Molecular Formula | C12H14ClFN4O |
| Molecular Weight | 284.72 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 2-[(1R,4R)-4-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]methyl]cyclopent-2-en-1-yl]acetamide |
| SMILES | NC(=O)C[C@@H]1C=C[C@H](CNc2nc(Cl)ncc2F)C1 |
| InChI | InChI=1S/C12H14ClFN4O/c13-12-17-6-9(14)11(18-12)16-5-8-2-1-7(3-8)4-10(15)19/h1-2,6-8H,3-5H2,(H2,15,19)(H,16,17,18)/t7-,8+/m1/s1 |
| InChIKey | YNBFQYINHNDKQM-SFYZADRCSA-N |
| XLogP | 1.75 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.72 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1R,4R)-4-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]methyl]cyclopent-2-en-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R,4R)-4-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]methyl]cyclopent-2-en-1-yl]acetamide?
The IUPAC name of 2-[(1R,4R)-4-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]methyl]cyclopent-2-en-1-yl]acetamide (CID 88987089) is 2-[(1R,4R)-4-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]methyl]cyclopent-2-en-1-yl]acetamide.
What is the SMILES notation for 2-[(1R,4R)-4-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]methyl]cyclopent-2-en-1-yl]acetamide?
The canonical SMILES for 2-[(1R,4R)-4-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]methyl]cyclopent-2-en-1-yl]acetamide is NC(=O)C[C@@H]1C=C[C@H](CNc2nc(Cl)ncc2F)C1.
What is the InChIKey of 2-[(1R,4R)-4-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]methyl]cyclopent-2-en-1-yl]acetamide?
The InChIKey is YNBFQYINHNDKQM-SFYZADRCSA-N. The full InChI is InChI=1S/C12H14ClFN4O/c13-12-17-6-9(14)11(18-12)16-5-8-2-1-7(3-8)4-10(15)19/h1-2,6-8H,3-5H2,(H2,15,19)(H,16,17,18)/t7-,8+/m1/s1.
What are the key properties of 2-[(1R,4R)-4-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]methyl]cyclopent-2-en-1-yl]acetamide?
2-[(1R,4R)-4-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]methyl]cyclopent-2-en-1-yl]acetamide has a molecular weight of 284.72 g/mol, XLogP of 1.75, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R,4R)-4-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]methyl]cyclopent-2-en-1-yl]acetamide is sourced from PubChem (CID 88987089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).