C12H14ClFN4O — CID 88987089
2-[(1R,4R)-4-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]methyl]cyclopent-2-en-1-yl]acetamide (PubChem CID 88987089) has the molecular formula C12H14ClFN4O and a molecular weight of 284.72 g/mol. Its IUPAC name is 2-[(1R,4R)-4-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]methyl]cyclopent-2-en-1-yl]acetamide.
| Compound Name | 2-[(1R,4R)-4-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]methyl]cyclopent-2-en-1-yl]acetamide |
|---|---|
| PubChem CID | 88987089 |
| Molecular Formula | C12H14ClFN4O |
| Molecular Weight | 284.72 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 2-[(1R,4R)-4-[[(2-chloro-5-fluoropyrimidin-4-yl)amino]methyl]cyclopent-2-en-1-yl]acetamide |
| SMILES | NC(=O)C[C@@H]1C=C[C@H](CNc2nc(Cl)ncc2F)C1 |
| InChI | InChI=1S/C12H14ClFN4O/c13-12-17-6-9(14)11(18-12)16-5-8-2-1-7(3-8)4-10(15)19/h1-2,6-8H,3-5H2,(H2,15,19)(H,16,17,18)/t7-,8+/m1/s1 |
| InChIKey | YNBFQYINHNDKQM-SFYZADRCSA-N |
| XLogP | 1.75 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.72 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|