C12H12ClFN4O — CID 143149985
(1R,4R)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 143149985) has the molecular formula C12H12ClFN4O and a molecular weight of 282.71 g/mol. Its IUPAC name is (1R,4R)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,4R)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 143149985 |
| Molecular Formula | C12H12ClFN4O |
| Molecular Weight | 282.71 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | (1R,4R)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | NC(=O)C1C(Nc2nc(Cl)ncc2F)[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C12H12ClFN4O/c13-12-16-4-7(14)11(18-12)17-9-6-2-1-5(3-6)8(9)10(15)19/h1-2,4-6,8-9H,3H2,(H2,15,19)(H,16,17,18)/t5-,6-,8?,9?/m0/s1 |
| InChIKey | NEHLKISJRXQNDS-VABKVPQOSA-N |
| XLogP | 1.36 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.71 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|