C13H14Cl2N4O — CID 87330193
(1R,2R,3S,4S)-3-[(2,5-dichloropyrimidin-4-yl)amino]-N-methylbicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 87330193) has the molecular formula C13H14Cl2N4O and a molecular weight of 313.19 g/mol. Its IUPAC name is (1R,2R,3S,4S)-3-[(2,5-dichloropyrimidin-4-yl)amino]-N-methylbicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,2R,3S,4S)-3-[(2,5-dichloropyrimidin-4-yl)amino]-N-methylbicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 87330193 |
| Molecular Formula | C13H14Cl2N4O |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | (1R,2R,3S,4S)-3-[(2,5-dichloropyrimidin-4-yl)amino]-N-methylbicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | CNC(=O)[C@H]1[C@@H](Nc2nc(Cl)ncc2Cl)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C13H14Cl2N4O/c1-16-12(20)9-6-2-3-7(4-6)10(9)18-11-8(14)5-17-13(15)19-11/h2-3,5-7,9-10H,4H2,1H3,(H,16,20)(H,17,18,19)/t6-,7+,9+,10-/m0/s1 |
| InChIKey | FNMIHMOULSZKPU-WDQPUEAGSA-N |
| XLogP | 2.13 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|