C13H13ClN6O — CID 118689248
3-[(2-chloro-7H-purin-6-yl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 118689248) has the molecular formula C13H13ClN6O and a molecular weight of 304.74 g/mol. Its IUPAC name is 3-[(2-chloro-7H-purin-6-yl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | 3-[(2-chloro-7H-purin-6-yl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 118689248 |
| Molecular Formula | C13H13ClN6O |
| Molecular Weight | 304.74 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 3-[(2-chloro-7H-purin-6-yl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | NC(=O)C1C2C=CC(C2)C1Nc1nc(Cl)nc2nc[nH]c12 |
| InChI | InChI=1S/C13H13ClN6O/c14-13-19-11-9(16-4-17-11)12(20-13)18-8-6-2-1-5(3-6)7(8)10(15)21/h1-2,4-8H,3H2,(H2,15,21)(H2,16,17,18,19,20) |
| InChIKey | HCPLSDZXOIOQPT-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.74 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|