C13H18ClN5 — CID 11587232
2-chloro-N-cyclooctyl-7H-purin-6-amine (PubChem CID 11587232) has the molecular formula C13H18ClN5 and a molecular weight of 279.77 g/mol. Its IUPAC name is 2-chloro-N-cyclooctyl-7H-purin-6-amine.
| Compound Name | 2-chloro-N-cyclooctyl-7H-purin-6-amine |
|---|---|
| PubChem CID | 11587232 |
| Molecular Formula | C13H18ClN5 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2-chloro-N-cyclooctyl-7H-purin-6-amine |
| SMILES | Clc1nc(NC2CCCCCCC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C13H18ClN5/c14-13-18-11-10(15-8-16-11)12(19-13)17-9-6-4-2-1-3-5-7-9/h8-9H,1-7H2,(H2,15,16,17,18,19) |
| InChIKey | CQLDJVZCCKQNAT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |