C9H12N6 — CID 18430660
6-N-cyclobutyl-7H-purine-2,6-diamine (PubChem CID 18430660) has the molecular formula C9H12N6 and a molecular weight of 204.24 g/mol. Its IUPAC name is 6-N-cyclobutyl-7H-purine-2,6-diamine.
| Compound Name | 6-N-cyclobutyl-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 18430660 |
| Molecular Formula | C9H12N6 |
| Molecular Weight | 204.24 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 6-N-cyclobutyl-7H-purine-2,6-diamine |
| SMILES | Nc1nc(NC2CCC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C9H12N6/c10-9-14-7-6(11-4-12-7)8(15-9)13-5-2-1-3-5/h4-5H,1-3H2,(H4,10,11,12,13,14,15) |
| InChIKey | JABZRJMCNBIAAQ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.24 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |