C11H16N6O — CID 104623891
4-[(2-amino-7H-purin-6-yl)amino]cyclohexan-1-ol (PubChem CID 104623891) has the molecular formula C11H16N6O and a molecular weight of 248.29 g/mol. Its IUPAC name is 4-[(2-amino-7H-purin-6-yl)amino]cyclohexan-1-ol.
| Compound Name | 4-[(2-amino-7H-purin-6-yl)amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 104623891 |
| Molecular Formula | C11H16N6O |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 4-[(2-amino-7H-purin-6-yl)amino]cyclohexan-1-ol |
| SMILES | Nc1nc(NC2CCC(O)CC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C11H16N6O/c12-11-16-9-8(13-5-14-9)10(17-11)15-6-1-3-7(18)4-2-6/h5-7,18H,1-4H2,(H4,12,13,14,15,16,17) |
| InChIKey | RLNJCXGLANBXSK-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |