C11H16N8 — CID 54444173
6-N-(1,4-diazabicyclo[2.2.2]octan-2-yl)-7H-purine-2,6-diamine (PubChem CID 54444173) has the molecular formula C11H16N8 and a molecular weight of 260.30 g/mol. Its IUPAC name is 6-N-(1,4-diazabicyclo[2.2.2]octan-2-yl)-7H-purine-2,6-diamine.
| Compound Name | 6-N-(1,4-diazabicyclo[2.2.2]octan-2-yl)-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 54444173 |
| Molecular Formula | C11H16N8 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 6-N-(1,4-diazabicyclo[2.2.2]octan-2-yl)-7H-purine-2,6-diamine |
| SMILES | Nc1nc(NC2CN3CCN2CC3)c2[nH]cnc2n1 |
| InChI | InChI=1S/C11H16N8/c12-11-16-9-8(13-6-14-9)10(17-11)15-7-5-18-1-3-19(7)4-2-18/h6-7H,1-5H2,(H4,12,13,14,15,16,17) |
| InChIKey | WQHRMLANAFGBJZ-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |