C9H14N6 — CID 114783406
6-N-tert-butyl-7H-purine-2,6-diamine (PubChem CID 114783406) has the molecular formula C9H14N6 and a molecular weight of 206.25 g/mol. Its IUPAC name is 6-N-tert-butyl-7H-purine-2,6-diamine.
| Compound Name | 6-N-tert-butyl-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 114783406 |
| Molecular Formula | C9H14N6 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 6-N-tert-butyl-7H-purine-2,6-diamine |
| SMILES | CC(C)(C)Nc1nc(N)nc2nc[nH]c12 |
| InChI | InChI=1S/C9H14N6/c1-9(2,3)15-7-5-6(12-4-11-5)13-8(10)14-7/h4H,1-3H3,(H4,10,11,12,13,14,15) |
| InChIKey | PEHFYTZVIVUPKZ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |