C11H20N7+ — CID 140616341
3-[(2-amino-7H-purin-6-yl)amino]propyl-trimethylazanium (PubChem CID 140616341) has the molecular formula C11H20N7+ and a molecular weight of 250.33 g/mol. Its IUPAC name is 3-[(2-amino-7H-purin-6-yl)amino]propyl-trimethylazanium.
| Compound Name | 3-[(2-amino-7H-purin-6-yl)amino]propyl-trimethylazanium |
|---|---|
| PubChem CID | 140616341 |
| Molecular Formula | C11H20N7+ |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 3-[(2-amino-7H-purin-6-yl)amino]propyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCCNc1nc(N)nc2nc[nH]c12 |
| InChI | InChI=1S/C11H20N7/c1-18(2,3)6-4-5-13-9-8-10(15-7-14-8)17-11(12)16-9/h7H,4-6H2,1-3H3,(H4,12,13,14,15,16,17)/q+1 |
| InChIKey | CNPVXNWAXUCJCC-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|