C12H19N7O — CID 104623604
3-[(2-amino-7H-purin-6-yl)amino]-N-tert-butylpropanamide (PubChem CID 104623604) has the molecular formula C12H19N7O and a molecular weight of 277.33 g/mol. Its IUPAC name is 3-[(2-amino-7H-purin-6-yl)amino]-N-tert-butylpropanamide.
| Compound Name | 3-[(2-amino-7H-purin-6-yl)amino]-N-tert-butylpropanamide |
|---|---|
| PubChem CID | 104623604 |
| Molecular Formula | C12H19N7O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 3-[(2-amino-7H-purin-6-yl)amino]-N-tert-butylpropanamide |
| SMILES | CC(C)(C)NC(=O)CCNc1nc(N)nc2nc[nH]c12 |
| InChI | InChI=1S/C12H19N7O/c1-12(2,3)19-7(20)4-5-14-9-8-10(16-6-15-8)18-11(13)17-9/h6H,4-5H2,1-3H3,(H,19,20)(H4,13,14,15,16,17,18) |
| InChIKey | JOVSBQVVLCLPLY-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |