C10H15N7O — CID 114143219
3-[(2-amino-7H-purin-6-yl)amino]-3-methylbutanamide (PubChem CID 114143219) has the molecular formula C10H15N7O and a molecular weight of 249.28 g/mol. Its IUPAC name is 3-[(2-amino-7H-purin-6-yl)amino]-3-methylbutanamide.
| Compound Name | 3-[(2-amino-7H-purin-6-yl)amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 114143219 |
| Molecular Formula | C10H15N7O |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 3-[(2-amino-7H-purin-6-yl)amino]-3-methylbutanamide |
| SMILES | CC(C)(CC(N)=O)Nc1nc(N)nc2nc[nH]c12 |
| InChI | InChI=1S/C10H15N7O/c1-10(2,3-5(11)18)17-8-6-7(14-4-13-6)15-9(12)16-8/h4H,3H2,1-2H3,(H2,11,18)(H4,12,13,14,15,16,17) |
| InChIKey | TVMCZZDJAQOSFP-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 135.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |