C8H11N7O2 — CID 141417768
2-[(2-amino-7H-purin-6-yl)amino]-N-hydroxypropanamide (PubChem CID 141417768) has the molecular formula C8H11N7O2 and a molecular weight of 237.22 g/mol. Its IUPAC name is 2-[(2-amino-7H-purin-6-yl)amino]-N-hydroxypropanamide.
| Compound Name | 2-[(2-amino-7H-purin-6-yl)amino]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 141417768 |
| Molecular Formula | C8H11N7O2 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 2-[(2-amino-7H-purin-6-yl)amino]-N-hydroxypropanamide |
| SMILES | CC(Nc1nc(N)nc2nc[nH]c12)C(=O)NO |
| InChI | InChI=1S/C8H11N7O2/c1-3(7(16)15-17)12-6-4-5(11-2-10-4)13-8(9)14-6/h2-3,17H,1H3,(H,15,16)(H4,9,10,11,12,13,14) |
| InChIKey | VVYNFBSTLATYBK-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 141.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|