C9H13N7O2 — CID 141417771
3-[(2-amino-7H-purin-6-yl)amino]-N-hydroxybutanamide (PubChem CID 141417771) has the molecular formula C9H13N7O2 and a molecular weight of 251.25 g/mol. Its IUPAC name is 3-[(2-amino-7H-purin-6-yl)amino]-N-hydroxybutanamide.
| Compound Name | 3-[(2-amino-7H-purin-6-yl)amino]-N-hydroxybutanamide |
|---|---|
| PubChem CID | 141417771 |
| Molecular Formula | C9H13N7O2 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 3-[(2-amino-7H-purin-6-yl)amino]-N-hydroxybutanamide |
| SMILES | CC(CC(=O)NO)Nc1nc(N)nc2nc[nH]c12 |
| InChI | InChI=1S/C9H13N7O2/c1-4(2-5(17)16-18)13-8-6-7(12-3-11-6)14-9(10)15-8/h3-4,18H,2H2,1H3,(H,16,17)(H4,10,11,12,13,14,15) |
| InChIKey | PUKGYCUTRVDKQR-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 141.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|