C11H18N6 — CID 67950737
6-N-[(3R)-2-methylpentan-3-yl]-7H-purine-2,6-diamine (PubChem CID 67950737) has the molecular formula C11H18N6 and a molecular weight of 234.31 g/mol. Its IUPAC name is 6-N-[(3R)-2-methylpentan-3-yl]-7H-purine-2,6-diamine.
| Compound Name | 6-N-[(3R)-2-methylpentan-3-yl]-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 67950737 |
| Molecular Formula | C11H18N6 |
| Molecular Weight | 234.31 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 6-N-[(3R)-2-methylpentan-3-yl]-7H-purine-2,6-diamine |
| SMILES | CC[C@@H](Nc1nc(N)nc2nc[nH]c12)C(C)C |
| InChI | InChI=1S/C11H18N6/c1-4-7(6(2)3)15-10-8-9(14-5-13-8)16-11(12)17-10/h5-7H,4H2,1-3H3,(H4,12,13,14,15,16,17)/t7-/m1/s1 |
| InChIKey | COOPGBMKVGILIM-SSDOTTSWSA-N |
| XLogP | 1.78 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |