C11H12N6O — CID 104623197
6-N-[1-(furan-2-yl)ethyl]-7H-purine-2,6-diamine (PubChem CID 104623197) has the molecular formula C11H12N6O and a molecular weight of 244.26 g/mol. Its IUPAC name is 6-N-[1-(furan-2-yl)ethyl]-7H-purine-2,6-diamine.
| Compound Name | 6-N-[1-(furan-2-yl)ethyl]-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 104623197 |
| Molecular Formula | C11H12N6O |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 6-N-[1-(furan-2-yl)ethyl]-7H-purine-2,6-diamine |
| SMILES | CC(Nc1nc(N)nc2nc[nH]c12)c1ccco1 |
| InChI | InChI=1S/C11H12N6O/c1-6(7-3-2-4-18-7)15-10-8-9(14-5-13-8)16-11(12)17-10/h2-6H,1H3,(H4,12,13,14,15,16,17) |
| InChIKey | IWIAFNMVNSPQDS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 105.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |