C11H11ClN6S — CID 104623268
6-N-[1-(5-chlorothiophen-2-yl)ethyl]-7H-purine-2,6-diamine (PubChem CID 104623268) has the molecular formula C11H11ClN6S and a molecular weight of 294.77 g/mol. Its IUPAC name is 6-N-[1-(5-chlorothiophen-2-yl)ethyl]-7H-purine-2,6-diamine.
| Compound Name | 6-N-[1-(5-chlorothiophen-2-yl)ethyl]-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 104623268 |
| Molecular Formula | C11H11ClN6S |
| Molecular Weight | 294.77 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 6-N-[1-(5-chlorothiophen-2-yl)ethyl]-7H-purine-2,6-diamine |
| SMILES | CC(Nc1nc(N)nc2nc[nH]c12)c1ccc(Cl)s1 |
| InChI | InChI=1S/C11H11ClN6S/c1-5(6-2-3-7(12)19-6)16-10-8-9(15-4-14-8)17-11(13)18-10/h2-5H,1H3,(H4,13,14,15,16,17,18) |
| InChIKey | MBUFENLJJFUWBH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.77 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |