C11H12ClN3O2S — CID 136974800
4-[1-(5-chlorothiophen-2-yl)ethylamino]-5-methoxy-1H-pyrimidin-6-one (PubChem CID 136974800) has the molecular formula C11H12ClN3O2S and a molecular weight of 285.76 g/mol. Its IUPAC name is 4-[1-(5-chlorothiophen-2-yl)ethylamino]-5-methoxy-1H-pyrimidin-6-one.
| Compound Name | 4-[1-(5-chlorothiophen-2-yl)ethylamino]-5-methoxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136974800 |
| Molecular Formula | C11H12ClN3O2S |
| Molecular Weight | 285.76 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | 4-[1-(5-chlorothiophen-2-yl)ethylamino]-5-methoxy-1H-pyrimidin-6-one |
| SMILES | COc1c(NC(C)c2ccc(Cl)s2)nc[nH]c1=O |
| InChI | InChI=1S/C11H12ClN3O2S/c1-6(7-3-4-8(12)18-7)15-10-9(17-2)11(16)14-5-13-10/h3-6H,1-2H3,(H2,13,14,15,16) |
| InChIKey | JUKDRNGJFUXFTK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.76 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |