C13H17N3O2S — CID 136974958
5-methoxy-4-(1-thiophen-2-ylbutylamino)-1H-pyrimidin-6-one (PubChem CID 136974958) has the molecular formula C13H17N3O2S and a molecular weight of 279.37 g/mol. Its IUPAC name is 5-methoxy-4-(1-thiophen-2-ylbutylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-methoxy-4-(1-thiophen-2-ylbutylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136974958 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 5-methoxy-4-(1-thiophen-2-ylbutylamino)-1H-pyrimidin-6-one |
| SMILES | CCCC(Nc1nc[nH]c(=O)c1OC)c1cccs1 |
| InChI | InChI=1S/C13H17N3O2S/c1-3-5-9(10-6-4-7-19-10)16-12-11(18-2)13(17)15-8-14-12/h4,6-9H,3,5H2,1-2H3,(H2,14,15,16,17) |
| InChIKey | AUAFWWPKMJQNSV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |