C13H16BrN3OS — CID 106997660
5-bromo-4-methoxy-N-(1-thiophen-2-ylbutyl)pyrimidin-2-amine (PubChem CID 106997660) has the molecular formula C13H16BrN3OS and a molecular weight of 342.26 g/mol. Its IUPAC name is 5-bromo-4-methoxy-N-(1-thiophen-2-ylbutyl)pyrimidin-2-amine.
| Compound Name | 5-bromo-4-methoxy-N-(1-thiophen-2-ylbutyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 106997660 |
| Molecular Formula | C13H16BrN3OS |
| Molecular Weight | 342.26 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 5-bromo-4-methoxy-N-(1-thiophen-2-ylbutyl)pyrimidin-2-amine |
| SMILES | CCCC(Nc1ncc(Br)c(OC)n1)c1cccs1 |
| InChI | InChI=1S/C13H16BrN3OS/c1-3-5-10(11-6-4-7-19-11)16-13-15-8-9(14)12(17-13)18-2/h4,6-8,10H,3,5H2,1-2H3,(H,15,16,17) |
| InChIKey | RVMQUJNLXNPDDX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.26 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |