C13H15BrN2S — CID 104776938
3-bromo-N-(1-thiophen-2-ylbutyl)pyridin-4-amine (PubChem CID 104776938) has the molecular formula C13H15BrN2S and a molecular weight of 311.25 g/mol. Its IUPAC name is 3-bromo-N-(1-thiophen-2-ylbutyl)pyridin-4-amine.
| Compound Name | 3-bromo-N-(1-thiophen-2-ylbutyl)pyridin-4-amine |
|---|---|
| PubChem CID | 104776938 |
| Molecular Formula | C13H15BrN2S |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 3-bromo-N-(1-thiophen-2-ylbutyl)pyridin-4-amine |
| SMILES | CCCC(Nc1ccncc1Br)c1cccs1 |
| InChI | InChI=1S/C13H15BrN2S/c1-2-4-12(13-5-3-8-17-13)16-11-6-7-15-9-10(11)14/h3,5-9,12H,2,4H2,1H3,(H,15,16) |
| InChIKey | XOYBXJPFNSXQFU-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |