C14H19N3S — CID 113367648
2-N-methyl-4-N-(1-thiophen-2-ylbutyl)pyridine-2,4-diamine (PubChem CID 113367648) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is 2-N-methyl-4-N-(1-thiophen-2-ylbutyl)pyridine-2,4-diamine.
| Compound Name | 2-N-methyl-4-N-(1-thiophen-2-ylbutyl)pyridine-2,4-diamine |
|---|---|
| PubChem CID | 113367648 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 2-N-methyl-4-N-(1-thiophen-2-ylbutyl)pyridine-2,4-diamine |
| SMILES | CCCC(Nc1ccnc(NC)c1)c1cccs1 |
| InChI | InChI=1S/C14H19N3S/c1-3-5-12(13-6-4-9-18-13)17-11-7-8-16-14(10-11)15-2/h4,6-10,12H,3,5H2,1-2H3,(H2,15,16,17) |
| InChIKey | KNOKGBOCUMGKSQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |