C12H17N3S2 — CID 65276998
3-ethyl-N-(1-thiophen-2-ylbutyl)-1,2,4-thiadiazol-5-amine (PubChem CID 65276998) has the molecular formula C12H17N3S2 and a molecular weight of 267.42 g/mol. Its IUPAC name is 3-ethyl-N-(1-thiophen-2-ylbutyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-ethyl-N-(1-thiophen-2-ylbutyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65276998 |
| Molecular Formula | C12H17N3S2 |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 3-ethyl-N-(1-thiophen-2-ylbutyl)-1,2,4-thiadiazol-5-amine |
| SMILES | CCCC(Nc1nc(CC)ns1)c1cccs1 |
| InChI | InChI=1S/C12H17N3S2/c1-3-6-9(10-7-5-8-16-10)13-12-14-11(4-2)15-17-12/h5,7-9H,3-4,6H2,1-2H3,(H,13,14,15) |
| InChIKey | SLOKLUTWYRYITM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |