C15H15N3S2 — CID 133485617
3-phenyl-N-(1-thiophen-2-ylpropyl)-1,2,4-thiadiazol-5-amine (PubChem CID 133485617) has the molecular formula C15H15N3S2 and a molecular weight of 301.44 g/mol. Its IUPAC name is 3-phenyl-N-(1-thiophen-2-ylpropyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-phenyl-N-(1-thiophen-2-ylpropyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 133485617 |
| Molecular Formula | C15H15N3S2 |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 3-phenyl-N-(1-thiophen-2-ylpropyl)-1,2,4-thiadiazol-5-amine |
| SMILES | CCC(Nc1nc(-c2ccccc2)ns1)c1cccs1 |
| InChI | InChI=1S/C15H15N3S2/c1-2-12(13-9-6-10-19-13)16-15-17-14(18-20-15)11-7-4-3-5-8-11/h3-10,12H,2H2,1H3,(H,16,17,18) |
| InChIKey | KWVWVHMIUWXZNE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |