C14H13ClN2S2 — CID 79525588
6-chloro-N-(1-thiophen-2-ylpropyl)-1,3-benzothiazol-2-amine (PubChem CID 79525588) has the molecular formula C14H13ClN2S2 and a molecular weight of 308.86 g/mol. Its IUPAC name is 6-chloro-N-(1-thiophen-2-ylpropyl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-chloro-N-(1-thiophen-2-ylpropyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 79525588 |
| Molecular Formula | C14H13ClN2S2 |
| Molecular Weight | 308.86 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 6-chloro-N-(1-thiophen-2-ylpropyl)-1,3-benzothiazol-2-amine |
| SMILES | CCC(Nc1nc2ccc(Cl)cc2s1)c1cccs1 |
| InChI | InChI=1S/C14H13ClN2S2/c1-2-10(12-4-3-7-18-12)16-14-17-11-6-5-9(15)8-13(11)19-14/h3-8,10H,2H2,1H3,(H,16,17) |
| InChIKey | IPCZWQMFLIEVGA-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.86 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |