C13H17ClN2S — CID 103462911
6-chloro-N-(2,2-dimethylbutyl)-1,3-benzothiazol-2-amine (PubChem CID 103462911) has the molecular formula C13H17ClN2S and a molecular weight of 268.81 g/mol. Its IUPAC name is 6-chloro-N-(2,2-dimethylbutyl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-chloro-N-(2,2-dimethylbutyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 103462911 |
| Molecular Formula | C13H17ClN2S |
| Molecular Weight | 268.81 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 6-chloro-N-(2,2-dimethylbutyl)-1,3-benzothiazol-2-amine |
| SMILES | CCC(C)(C)CNc1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C13H17ClN2S/c1-4-13(2,3)8-15-12-16-10-6-5-9(14)7-11(10)17-12/h5-7H,4,8H2,1-3H3,(H,15,16) |
| InChIKey | LPOIUIFDCHGCGA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.81 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |