C12H14ClNS — CID 70828604
6-chloro-2-(2-methylbutan-2-yl)-1,3-benzothiazole (PubChem CID 70828604) has the molecular formula C12H14ClNS and a molecular weight of 239.77 g/mol. Its IUPAC name is 6-chloro-2-(2-methylbutan-2-yl)-1,3-benzothiazole.
| Compound Name | 6-chloro-2-(2-methylbutan-2-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 70828604 |
| Molecular Formula | C12H14ClNS |
| Molecular Weight | 239.77 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 6-chloro-2-(2-methylbutan-2-yl)-1,3-benzothiazole |
| SMILES | CCC(C)(C)c1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C12H14ClNS/c1-4-12(2,3)11-14-9-6-5-8(13)7-10(9)15-11/h5-7H,4H2,1-3H3 |
| InChIKey | UPQGWRYJFPWORB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.77 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |