C13H14ClNO2S — CID 79527845
4-(6-chloro-1,3-benzothiazol-2-yl)-3,3-dimethylbutanoic acid (PubChem CID 79527845) has the molecular formula C13H14ClNO2S and a molecular weight of 283.78 g/mol. Its IUPAC name is 4-(6-chloro-1,3-benzothiazol-2-yl)-3,3-dimethylbutanoic acid.
| Compound Name | 4-(6-chloro-1,3-benzothiazol-2-yl)-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 79527845 |
| Molecular Formula | C13H14ClNO2S |
| Molecular Weight | 283.78 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 4-(6-chloro-1,3-benzothiazol-2-yl)-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(CC(=O)O)Cc1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C13H14ClNO2S/c1-13(2,7-12(16)17)6-11-15-9-4-3-8(14)5-10(9)18-11/h3-5H,6-7H2,1-2H3,(H,16,17) |
| InChIKey | ZCPGIZGXDZVTOI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.78 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |