(6-chloro-1,3-benzothiazol-2-yl)methylphosphonic acid

C8H7ClNO3PS — CID 122438694

IUPAC(6-chloro-1,3-benzothiazol-2-yl)methylphosphonic acid
SMILESO=P(O)(O)Cc1nc2ccc(Cl)cc2s1
InChIInChI=1S/C8H7ClNO3PS/c9-5-1-2-6-7(3-5)15-8(10-6)4-14(11,12)13/h1-3H,4H2,(H2,11,12,13)
InChIKeyUQZPOKNRBGDERD-UHFFFAOYSA-N
MW263.64 g/mol
LogP2.63
Rot. Bonds2

About (6-chloro-1,3-benzothiazol-2-yl)methylphosphonic acid

(6-chloro-1,3-benzothiazol-2-yl)methylphosphonic acid (PubChem CID 122438694) has the molecular formula C8H7ClNO3PS and a molecular weight of 263.64 g/mol. Its IUPAC name is (6-chloro-1,3-benzothiazol-2-yl)methylphosphonic acid.

Molecular Properties

Compound Name(6-chloro-1,3-benzothiazol-2-yl)methylphosphonic acid
PubChem CID122438694
Molecular FormulaC8H7ClNO3PS
Molecular Weight263.64 g/mol
Exact Mass262.96
IUPAC Name(6-chloro-1,3-benzothiazol-2-yl)methylphosphonic acid
SMILESO=P(O)(O)Cc1nc2ccc(Cl)cc2s1
InChIInChI=1S/C8H7ClNO3PS/c9-5-1-2-6-7(3-5)15-8(10-6)4-14(11,12)13/h1-3H,4H2,(H2,11,12,13)
InChIKeyUQZPOKNRBGDERD-UHFFFAOYSA-N
XLogP2.63
TPSA70.42 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.64
LogP ≤ 52.63
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze (6-chloro-1,3-benzothiazol-2-yl)methylphosphonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (6-chloro-1,3-benzothiazol-2-yl)methylphosphonic acid?
The IUPAC name of (6-chloro-1,3-benzothiazol-2-yl)methylphosphonic acid (CID 122438694) is (6-chloro-1,3-benzothiazol-2-yl)methylphosphonic acid.
What is the SMILES notation for (6-chloro-1,3-benzothiazol-2-yl)methylphosphonic acid?
The canonical SMILES for (6-chloro-1,3-benzothiazol-2-yl)methylphosphonic acid is O=P(O)(O)Cc1nc2ccc(Cl)cc2s1.
What is the InChIKey of (6-chloro-1,3-benzothiazol-2-yl)methylphosphonic acid?
The InChIKey is UQZPOKNRBGDERD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClNO3PS/c9-5-1-2-6-7(3-5)15-8(10-6)4-14(11,12)13/h1-3H,4H2,(H2,11,12,13).
What are the key properties of (6-chloro-1,3-benzothiazol-2-yl)methylphosphonic acid?
(6-chloro-1,3-benzothiazol-2-yl)methylphosphonic acid has a molecular weight of 263.64 g/mol, XLogP of 2.63, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-1,3-benzothiazol-2-yl)methylphosphonic acid is sourced from PubChem (CID 122438694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).