C8H7ClNO3PS — CID 122438694
(6-chloro-1,3-benzothiazol-2-yl)methylphosphonic acid (PubChem CID 122438694) has the molecular formula C8H7ClNO3PS and a molecular weight of 263.64 g/mol. Its IUPAC name is (6-chloro-1,3-benzothiazol-2-yl)methylphosphonic acid.
| Compound Name | (6-chloro-1,3-benzothiazol-2-yl)methylphosphonic acid |
|---|---|
| PubChem CID | 122438694 |
| Molecular Formula | C8H7ClNO3PS |
| Molecular Weight | 263.64 g/mol |
| Exact Mass | 262.96 |
| IUPAC Name | (6-chloro-1,3-benzothiazol-2-yl)methylphosphonic acid |
| SMILES | O=P(O)(O)Cc1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C8H7ClNO3PS/c9-5-1-2-6-7(3-5)15-8(10-6)4-14(11,12)13/h1-3H,4H2,(H2,11,12,13) |
| InChIKey | UQZPOKNRBGDERD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.64 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|