C11H13ClN2S — CID 79528112
N-[(6-chloro-1,3-benzothiazol-2-yl)methyl]propan-2-amine (PubChem CID 79528112) has the molecular formula C11H13ClN2S and a molecular weight of 240.76 g/mol. Its IUPAC name is N-[(6-chloro-1,3-benzothiazol-2-yl)methyl]propan-2-amine.
| Compound Name | N-[(6-chloro-1,3-benzothiazol-2-yl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 79528112 |
| Molecular Formula | C11H13ClN2S |
| Molecular Weight | 240.76 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | N-[(6-chloro-1,3-benzothiazol-2-yl)methyl]propan-2-amine |
| SMILES | CC(C)NCc1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C11H13ClN2S/c1-7(2)13-6-11-14-9-4-3-8(12)5-10(9)15-11/h3-5,7,13H,6H2,1-2H3 |
| InChIKey | WHHKUYJVNUTIIS-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.76 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |