C11H11ClN2S — CID 79529056
N-[(6-chloro-1,3-benzothiazol-2-yl)methyl]prop-2-en-1-amine (PubChem CID 79529056) has the molecular formula C11H11ClN2S and a molecular weight of 238.74 g/mol. Its IUPAC name is N-[(6-chloro-1,3-benzothiazol-2-yl)methyl]prop-2-en-1-amine.
| Compound Name | N-[(6-chloro-1,3-benzothiazol-2-yl)methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 79529056 |
| Molecular Formula | C11H11ClN2S |
| Molecular Weight | 238.74 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | N-[(6-chloro-1,3-benzothiazol-2-yl)methyl]prop-2-en-1-amine |
| SMILES | C=CCNCc1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C11H11ClN2S/c1-2-5-13-7-11-14-9-4-3-8(12)6-10(9)15-11/h2-4,6,13H,1,5,7H2 |
| InChIKey | PGGCEYXAPRFJDH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.74 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|