C15H13ClN2S — CID 115340106
4-[2-(6-chloro-1,3-benzothiazol-2-yl)ethyl]aniline (PubChem CID 115340106) has the molecular formula C15H13ClN2S and a molecular weight of 288.80 g/mol. Its IUPAC name is 4-[2-(6-chloro-1,3-benzothiazol-2-yl)ethyl]aniline.
| Compound Name | 4-[2-(6-chloro-1,3-benzothiazol-2-yl)ethyl]aniline |
|---|---|
| PubChem CID | 115340106 |
| Molecular Formula | C15H13ClN2S |
| Molecular Weight | 288.80 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 4-[2-(6-chloro-1,3-benzothiazol-2-yl)ethyl]aniline |
| SMILES | Nc1ccc(CCc2nc3ccc(Cl)cc3s2)cc1 |
| InChI | InChI=1S/C15H13ClN2S/c16-11-4-7-13-14(9-11)19-15(18-13)8-3-10-1-5-12(17)6-2-10/h1-2,4-7,9H,3,8,17H2 |
| InChIKey | DPARIIYADDIIFP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.80 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|