C19H14Cl2N2OS2 — CID 174833116
1,5-bis(6-chloro-1,3-benzothiazol-2-yl)pentan-3-one (PubChem CID 174833116) has the molecular formula C19H14Cl2N2OS2 and a molecular weight of 421.37 g/mol. Its IUPAC name is 1,5-bis(6-chloro-1,3-benzothiazol-2-yl)pentan-3-one.
| Compound Name | 1,5-bis(6-chloro-1,3-benzothiazol-2-yl)pentan-3-one |
|---|---|
| PubChem CID | 174833116 |
| Molecular Formula | C19H14Cl2N2OS2 |
| Molecular Weight | 421.37 g/mol |
| Exact Mass | 419.99 |
| IUPAC Name | 1,5-bis(6-chloro-1,3-benzothiazol-2-yl)pentan-3-one |
| SMILES | O=C(CCc1nc2ccc(Cl)cc2s1)CCc1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C19H14Cl2N2OS2/c20-11-1-5-14-16(9-11)25-18(22-14)7-3-13(24)4-8-19-23-15-6-2-12(21)10-17(15)26-19/h1-2,5-6,9-10H,3-4,7-8H2 |
| InChIKey | YWPKRDORXPUFQI-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.37 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |