C17H21ClN2OS — CID 142442719
N-[3-(6-chloro-1,3-benzothiazol-2-yl)propyl]-2-cyclopentylacetamide (PubChem CID 142442719) has the molecular formula C17H21ClN2OS and a molecular weight of 336.89 g/mol. Its IUPAC name is N-[3-(6-chloro-1,3-benzothiazol-2-yl)propyl]-2-cyclopentylacetamide.
| Compound Name | N-[3-(6-chloro-1,3-benzothiazol-2-yl)propyl]-2-cyclopentylacetamide |
|---|---|
| PubChem CID | 142442719 |
| Molecular Formula | C17H21ClN2OS |
| Molecular Weight | 336.89 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-[3-(6-chloro-1,3-benzothiazol-2-yl)propyl]-2-cyclopentylacetamide |
| SMILES | O=C(CC1CCCC1)NCCCc1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C17H21ClN2OS/c18-13-7-8-14-15(11-13)22-17(20-14)6-3-9-19-16(21)10-12-4-1-2-5-12/h7-8,11-12H,1-6,9-10H2,(H,19,21) |
| InChIKey | OIZCMVPFONTXDN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.89 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|