C17H25NO — CID 59168672
2-cyclohexyl-N-(3-phenylpropyl)acetamide (PubChem CID 59168672) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is 2-cyclohexyl-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-cyclohexyl-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 59168672 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 2-cyclohexyl-N-(3-phenylpropyl)acetamide |
| SMILES | O=C(CC1CCCCC1)NCCCc1ccccc1 |
| InChI | InChI=1S/C17H25NO/c19-17(14-16-10-5-2-6-11-16)18-13-7-12-15-8-3-1-4-9-15/h1,3-4,8-9,16H,2,5-7,10-14H2,(H,18,19) |
| InChIKey | JXMRKXVCPJBWIN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|